Evaluate the impact of hydrophobic regions in lipids on their structural diversity.

How does the amphipathic nature of phospholipids impact their function in cell membranes?

Which category would triglycerides fall under in a lipid map?

In the numbering system for fatty acids, which carbon is designated as the alpha carbon?

How does the cis conformation of double bonds in unsaturated fatty acids affect their physical properties?

Which type of fatty acid is predominantly found in oils, and what does this indicate about its melting point?

Given a fatty acid with the structure CH3(CH2)16COOH, how many carbon atoms are present for shorthand naming?

How would you write the shorthand name for a fatty acid with 22 carbon atoms and 5 double bonds?

Analyze the differences between systematic and shorthand naming systems for a fatty acid with the structure CH3(CH2)7CH=CH(CH2)7COOH.

Which of the following is a key omega 3 fatty acid?

Analyze the structural difference between omega 3 and omega 6 fatty acids.

How might the structure of omega fatty acids be used as a mnemonic to remember their dietary sources?

Why are fatty acid chains in triacylglycerols sometimes referred to as 'tails'?

How can you distinguish between simple and mixed triacylglycerols?