Biochemistry
Which of the following is NOT a fatty acid nomenclature system?
How would you write the shorthand name for a fatty acid with 20 carbon atoms and 3 double bonds?
What does the Greek letter delta with a superscript indicate in fatty acid nomenclature?
Given a fatty acid with double bonds at positions 9 and 12, how would you represent this in shorthand nomenclature using the Greek letter delta?
A fatty acid has the structure CH3(CH2)5CH=CHCH2CH=CH(CH2)7COOH. How many double bonds are present?
Which carbon is numbered as 2 in a fatty acid for shorthand naming purposes?
Which of the following correctly compares the shorthand and common naming systems for oleic acid?
