Skip to main content
Ch.3 - Chemical Reactions and Reaction Stoichiometry
Brown - Chemistry: The Central Science 14th Edition
Brown14th EditionChemistry: The Central ScienceISBN: 9780134414232Non è quello che usi tu?Cambia libro di testo
Tutti i libri di testoBrown 14th EditionCh.3 - Chemical Reactions and Reaction StoichiometryProblema 116
Capitolo 3, Problema 116

One of the most bizarre reactions in chemistry is called the Ugi reaction: R1C(=O)R2 + R3 - NH2 + R4COOH + R5NC S R4C(=O)N(R3)C(R1R2)C=ONHR5 + H2O Chemical structure diagram illustrating the Ugi reaction with hexyl groups.
(a) Write out the balanced chemical equation for the Ugi reaction, for the case where R = CH3CH2CH2CH2CH2CH2— (this is called the hexyl group) for all compounds.

Guida verificata passo dopo passo
1
Identify the reactants and products in the Ugi reaction: R1C(=O)R2, R3-NH2, R4COOH, and R5NC.
Substitute the hexyl group (CH3CH2CH2CH2CH2CH2—) for each R group in the reaction.
Write the chemical formula for each reactant with the hexyl group: CH3CH2CH2CH2CH2CH2C(=O)CH3, CH3CH2CH2CH2CH2CH2-NH2, CH3CH2CH2CH2CH2CH2COOH, and CH3CH2CH2CH2CH2CH2NC.
Combine the reactants to form the product: CH3CH2CH2CH2CH2CH2C(=O)N(CH3CH2CH2CH2CH2CH2)C(CH3CH2CH2CH2CH2CH2CH3)C=ONHCH3CH2CH2CH2CH2CH2 + H2O.
Ensure the chemical equation is balanced by checking that the number of atoms of each element is the same on both sides of the equation.

Risposta video verificata per un problema simile:

Questa soluzione video è stata consigliata dai nostri tutor come utile per risolvere questo problema.
Durata del video:
2m

Concetti chiave

Ecco i concetti essenziali che devi comprendere per rispondere correttamente alla domanda.

Ugi Reaction

The Ugi reaction is a multicomponent reaction that combines an isocyanide, an aldehyde or ketone, an amine, and a carboxylic acid to form a β-amino acid. This reaction is notable for its ability to create complex molecules from simple starting materials in a single step, making it valuable in organic synthesis and medicinal chemistry.
Video consigliato:
Percorso guidato
01:30
Alcohol Reactions: Dehydration Reactions

Balanced Chemical Equation

A balanced chemical equation represents a chemical reaction with equal numbers of each type of atom on both sides of the equation. Balancing ensures the law of conservation of mass is upheld, meaning that matter is neither created nor destroyed during the reaction. This is crucial for accurately predicting the amounts of reactants and products involved.
Video consigliato:
Percorso guidato
01:32
Balancing Chemical Equations

Hexyl Group

The hexyl group is a hydrocarbon chain consisting of six carbon atoms (C6H13) and is derived from hexane. In the context of the Ugi reaction, substituting the hexyl group into the reactants allows for the exploration of how different alkyl chains affect the reaction's outcome and the properties of the resulting compounds.
Video consigliato:
Percorso guidato
00:51
The Alkyl Groups Example
Pratica correlata
Domanda del libro di testo

The thermite reaction, Fe2O3 + Al → Al2O3 + Fe produces so much heat that the Fe product melts. This reaction is used industrially to weld metal parts under water, where a torch cannot be employed. It is also a favorite chemical demonstration in the lecture hall (on a small scale). (c) This reaction produces 852 kJ of heat per mole of Fe2O3 reacted. How many grams of Fe2O3 are needed to produce 1.00 × 104 kJ of heat?

Domanda del libro di testo

The thermite reaction, Fe2O3 + Al → Al2O3 + Fe produces so much heat that the Fe product melts. This reaction is used industrially to weld metal parts under water, where a torch cannot be employed. It is also a favorite chemical demonstration in the lecture hall (on a small scale). (b) Calculate how many grams of aluminum are needed to completely react with 500.0 g of Fe2O3 in this reaction.

5666
views
Domanda del libro di testo

The thermite reaction, Fe2O3 + Al S Al2O3 + Fe produces so much heat that the Fe product melts. This reaction is used industrially to weld metal parts under water, where a torch cannot be employed. It is also a favorite chemical demonstration in the lecture hall (on a small scale). (d) If you performed the reverse reaction— aluminum oxide plus iron makes iron oxide plus aluminum—would that reaction have heat as a reactant or a product?

1422
views