Unisciti a migliaia di studenti che si affidano a noi per superare al meglio i loro esami!
Scelta multipla
Calculate Ka of proprionic acid (CH 3CH2CO2H) if [CH3CH2CO2H]eq = 0.2 M & [CH3CH2CO2-]eq = 1.62 x 10-3 M.
A
Ka = 1.3 x 10-5
B
Ka = 7.8 x 10-10
C
Ka = 3.9 x 10-12
D
Ka = 5.1 x 10-4
4 Commenti
Guida verificata passo dopo passo
1
Understand that the acid dissociation constant (Ka) is a measure of the strength of an acid in solution. It is defined by the equilibrium concentrations of the acid and its dissociated ions.
Write the chemical equation for the dissociation of propionic acid: CH3CH2CO2H ⇌ CH3CH2CO2- + H+.
Use the expression for Ka: Ka = [CH3CH2CO2-][H+]/[CH3CH2CO2H]. Note that [H+] is equal to [CH3CH2CO2-] at equilibrium for a weak acid.
Substitute the given equilibrium concentrations into the Ka expression: Ka = (1.62 x 10^-3 M)(1.62 x 10^-3 M)/(0.2 M).
Calculate the value of Ka using the substituted values, ensuring to maintain the correct units and significant figures throughout the calculation.