Domanda del libro di testo(a) Draw Lewis structures for chloromethane 1CH3Cl2, chloroethene 1C2H3Cl2, and chloroethyne 1C2HCl2. Draw Lewis structures for chloromethane 1CH3Cl2.322views
Domanda del libro di testoWrite the structural formulas of three different compounds that each have the molecular formula C5H12.1164views
Domanda apertaGive the IUPAC name for the following compound CH3(CH2)3CH(CH2CH2CH3)CH(CH3)2.1058views
Domanda apertaBe sure to answer all parts. give the IUPAC name for the following compound. 2xsafari1300views1rank