Determine the product created under the following oxidation reaction.
A
B
C
D
CH3CH2CH2CH2CH3
0 댓글
검증된 단계별 안내
1
Identify the starting material and the type of reaction. The starting material is a secondary alcohol, as shown in the second image, with the structure CH3CH2C(OH)(CH2CH3)CH2CH3.
Recognize that the reaction is an oxidation reaction. In organic chemistry, oxidation of alcohols typically involves the conversion of alcohols to carbonyl compounds.
Determine the type of alcohol being oxidized. Secondary alcohols are oxidized to ketones.
Predict the product of the oxidation. The secondary alcohol CH3CH2C(OH)(CH2CH3)CH2CH3 will be oxidized to a ketone, specifically CH3CH2C(=O)CH2CH3, as shown in the fourth image.
Verify the structure of the product. The ketone product has a carbonyl group (C=O) replacing the hydroxyl group (OH) of the secondary alcohol, consistent with the structure in the fourth image.