Skip to main content
Ch.16 Amines
McMurry - Fundamentals of General, Organic, and Biological Chemistry 8th Edition
McMurry8th EditionFundamentals of General, Organic, and Biological ChemistryISBN: 9780134015187Non è quello che usi tu?Cambia libro di testo
Capitolo 16, Problema 30a

Draw the structures corresponding to the following names:
a. N-Methylpentylamine

Guida verificata passo dopo passo
1
Step 1: Understand the name of the compound. 'N-Methylpentylamine' indicates that the compound is an amine (contains an -NH2 group) with a methyl group attached to the nitrogen atom (N). The 'pentyl' part refers to a five-carbon chain attached to the nitrogen.
Step 2: Begin by drawing the pentyl group. A pentyl group is a straight-chain alkyl group with five carbon atoms: CH3-CH2-CH2-CH2-CH2.
Step 3: Attach the nitrogen atom to the end of the pentyl chain. This forms the base structure of pentylamine: CH3-CH2-CH2-CH2-CH2-NH2.
Step 4: Add the methyl group to the nitrogen atom. Replace one of the hydrogen atoms on the nitrogen with a CH3 group, resulting in the structure CH3-CH2-CH2-CH2-CH2-N(CH3)H.
Step 5: Verify the structure. Ensure that the nitrogen has three bonds (one to the pentyl group, one to the methyl group, and one to a hydrogen atom) and that the pentyl chain is correctly drawn with five carbons.

Concetti chiave

Ecco i concetti essenziali che devi comprendere per rispondere correttamente alla domanda.

Nomenclature in Organic Chemistry

Nomenclature refers to the systematic naming of chemical compounds based on established rules. In organic chemistry, names often indicate the structure and functional groups present in a molecule. Understanding the IUPAC naming conventions is essential for interpreting compound names and drawing their structures accurately.
Video consigliato:
Percorso guidato
2:26
Introduction to Organic Chemistry Concept 1

Aliphatic Amines

Aliphatic amines are organic compounds that contain one or more amino groups (-NH2, -NHR, or -NR2) attached to aliphatic carbon chains. In the case of N-Methylpentylamine, the structure includes a pentyl chain with a methyl group attached to the nitrogen atom, which influences the compound's properties and reactivity.
Video consigliato:
Percorso guidato
0:54
Amine Classification Example 1

Structural Representation of Molecules

Structural representation involves depicting the arrangement of atoms within a molecule, including bonds and functional groups. Common methods include Lewis structures, condensed formulas, and skeletal structures. Accurately drawing these representations is crucial for visualizing molecular geometry and understanding chemical behavior.
Video consigliato:
Percorso guidato
2:08
Molecular Representations Concept 1