Skip to main content
Ch.3 - Structure and Stereochemistry of Alkanes
Wade - Organic Chemistry 9th Edition
Wade9th EditionOrganic ChemistryISBN: 9780135213728Non è quello che usi tu?Cambia libro di testo
Tutti i libri di testoWade 9th EditionCh.3 - Structure and Stereochemistry of AlkanesProblema 39a,b
Capitolo 3, Problema 39a,b

Give the IUPAC names of the following alkanes.
(a) CH3C(CH3)2CH(CH2CH3)CH2CH2CH(CH3)2
(b)

Guida verificata passo dopo passo
1
Step 1: Identify the longest continuous carbon chain in the molecule. This will determine the base name of the alkane. Count the number of carbon atoms in this chain.
Step 2: Number the carbon atoms in the longest chain starting from the end nearest to the first branch point. This ensures the lowest possible numbers for substituents.
Step 3: Identify and name the substituents (branches) attached to the main chain. These are typically alkyl groups such as methyl (CH₃) or ethyl (C₂H₅).
Step 4: Assign a number to each substituent based on the carbon atom it is attached to in the main chain. Use these numbers to indicate the position of each substituent.
Step 5: Combine the names of the substituents with the base name of the alkane, using the numbers to indicate their positions. Arrange substituents alphabetically and use prefixes like di-, tri- if there are multiple identical substituents.

Risposta video verificata per un problema simile:

Questa soluzione video è stata consigliata dai nostri tutor come utile per risolvere questo problema.
Durata del video:
3m

Concetti chiave

Ecco i concetti essenziali che devi comprendere per rispondere correttamente alla domanda.

IUPAC Nomenclature

IUPAC nomenclature is a systematic method of naming organic chemical compounds as recommended by the International Union of Pure and Applied Chemistry. It involves identifying the longest carbon chain, numbering the chain to give substituents the lowest possible numbers, and naming substituents as prefixes. This ensures consistency and clarity in chemical communication.
Video consigliato:
03:43
The different parts of an IUPAC name

Alkane Structure

Alkanes are saturated hydrocarbons consisting entirely of single-bonded carbon and hydrogen atoms, with the general formula CnH2n+2. Understanding the structure of alkanes is crucial for naming them, as it involves recognizing the main carbon chain and any branching substituents. Alkanes are named based on the number of carbon atoms in the longest chain.
Video consigliato:
02:47
Functionalizing Alkanes

Substituent Identification

Substituents are groups of atoms attached to the main carbon chain in an organic molecule. Identifying and naming substituents correctly is essential for IUPAC nomenclature. Common substituents include alkyl groups like methyl (CH3-) and ethyl (C2H5-), which are named and numbered based on their position on the main chain to ensure accurate chemical identification.
Video consigliato:
01:47
Nucleophiles and Electrophiles can react in Substitution Reactions.
Pratica correlata
Domanda del libro di testo

Construct a graph, similar to Figure 3-11, of the torsional energy of 3-methylpentane along the C2―C3 bond.

a. Place C2 in front, represented by three bonds coming together in a Y shape, and C3 in back, represented by a circle with three bonds pointing out from it.

b. Define the dihedral angle as the angle between the methyl group on the front carbon and the ethyl group on the back carbon.

1353
views
Domanda del libro di testo

Construct a graph, similar to Figure 3-11, of the torsional energy of 3-methylpentane along the C2―C3 bond.

e. Indicate which conformations are the most stable (lowest energy) and the least stable (highest energy).

1279
views
Domanda del libro di testo

Construct a graph, similar to Figure 3-11, of the torsional energy of 3-methylpentane along the C2―C3 bond.

c. Begin your graph at the 0° dihedral angle and begin to turn the front carbon.

1730
views
Domanda del libro di testo

Each of the following descriptions applies to more than one alkane. In each case, draw and name two structures that match the description.

c. a cis-diethylcyclohexane

d. a trans-dihalocyclopentane

1453
views
Domanda del libro di testo

Each of the following descriptions applies to more than one alkane. In each case, draw and name two structures that match the description.

e. a (2,3-dimethylpentyl)cycloalkane

622
views
Domanda del libro di testo

Each of the following descriptions applies to more than one alkane. In each case, draw and name two structures that match the description.

f. a bicyclononane

664
views