교과서 질문Identify the following compounds as primary, secondary, or tertiary amines.a. CH3(CH2)4CH2NH2801views
교과서 질문Identify the following compounds as primary, secondary, or tertiary amines.b. CH3CH2CH2NHCH(CH3)2759views
교과서 질문a. For the compound above, identify each nitrogen as either a primary, secondary, tertiary, quaternary, or aromatic amine.1383views
교과서 질문Provide compounds that fit the following descriptions:a. Two amines that are gases at room temperatureb. A heterocyclic aminec. A compound with an amine group on an aromatic ring845views
교과서 질문Classify each of the following amines as primary (1°), secondary (2°), or tertiary (3°):c 669views
교과서 질문Classify each of the following amines as primary (1°), secondary (2°), or tertiary (3°):d. 651views
교과서 질문Classify each of the following amines as primary (1°), secondary (2°), or tertiary (3°):c. 688views