Give a systematic (IUPAC) name for each diol(a) CH3CH(OH)(CH2)4CH(OH)C(CH3)3(b) HO-(CH2)8-OH(c)

Ch.10 - Structure and Synthesis of Alcohols

Wade9th EditionOrganic ChemistryISBN: 9780135213728Non è quello che usi tu?Cambia libro di testo

Tutti i libri di testo

Wade 9th Edition

Ch.10 - Structure and Synthesis of Alcohols

Problema 4a,b,c

Capitolo 10, Problema 4a,b,c

Give a systematic (IUPAC) name for each diol
(a) CH₃CH(OH)(CH₂)₄CH(OH)C(CH₃)₃
(b) HO-(CH2)₈-OH
(c)

Guida verificata passo dopo passo

Step 1: Analyze the structure of compound (a). Identify the longest carbon chain containing both hydroxyl groups. The parent chain has 8 carbons, and the hydroxyl groups are located on carbons 2 and 7. Assign the lowest possible locants to the hydroxyl groups.

Step 2: For compound (a), name the substituents. There is a tert-butyl group attached to carbon 7. Combine the substituent name with the parent chain name, ensuring proper placement of locants.

Step 3: Analyze compound (b). This is a straight-chain diol with 8 carbons. The hydroxyl groups are located at both ends of the chain (positions 1 and 8). Use the prefix 'octane' for the parent chain and add 'diol' to indicate two hydroxyl groups.

Step 4: For compound (c) (image provided), identify the parent chain as cyclohexene. The hydroxyl groups are located on carbons 1 and 2, and both are in cis configuration. Use the prefix 'cyclohexene' and add 'diol' to indicate two hydroxyl groups. Specify the stereochemistry as 'cis'.

Step 5: Combine all elements for each compound systematically. Ensure proper IUPAC naming conventions are followed, including locants, substituents, and stereochemistry where applicable.

Risposta video verificata per un problema simile:

Questa soluzione video è stata consigliata dai nostri tutor come utile per risolvere questo problema.

Durata del video:

10m

Concetti chiave

Ecco i concetti essenziali che devi comprendere per rispondere correttamente alla domanda.

IUPAC Nomenclature

IUPAC nomenclature is a systematic method for naming organic chemical compounds. It provides rules for naming based on the structure of the molecule, including the longest carbon chain, functional groups, and their positions. Understanding these rules is essential for accurately naming compounds, especially those with multiple functional groups like diols.

Video consigliato:

03:43

The different parts of an IUPAC name

Diols

Diols, also known as glycols, are organic compounds containing two hydroxyl (-OH) groups. Their properties and reactivity can differ significantly from those of alcohols with a single hydroxyl group. Recognizing the structure and functional groups of diols is crucial for determining their IUPAC names and understanding their chemical behavior.

Video consigliato:

01:49

Provide the correct common and IUPAC name.

Structural Isomerism

Structural isomerism occurs when compounds have the same molecular formula but different structural arrangements of atoms. This concept is important in organic chemistry as it affects the physical and chemical properties of compounds. Identifying isomers is key when naming compounds, particularly for diols that may have multiple structural forms.

Video consigliato:

06:47

Monosaccharides - D and L Isomerism

Pratica correlata

Domanda del libro di testo

Dimethylamine, (CH₃)₂NH, has a molecular weight of 45 and a boiling point of 7.4 °C. Trimethylamine, (CH₃)₃N, has a higher molecular weight (59) but a lower boiling point (3.5 °C). Explain this apparent discrepancy.

1425

views

Domanda del libro di testo

For each molecular formula, draw all the possible constitutional isomers of alcohols with that formula. Give the IUPAC name for each alcohol.

734

views

Domanda del libro di testo

For each molecular formula, draw all the possible constitutional isomers of alcohols with that formula. Give the IUPAC name for each alcohol.

(b) C₄H₁₀O

1246

views

Domanda del libro di testo