Dimethylamine, (CH3)2NH, has a molecular weight of 45 and a boiling point of 7.4 °C. Trimethylamine, (CH3)3N, has a higher molecular weight (59) but a lower boiling point (3.5 °C). Explain this apparent discrepancy.
Give a systematic (IUPAC) name for each diol
(d) 
(e) 
Guida verificata passo dopo passo
Risposta video verificata per un problema simile:
Concetti chiave
IUPAC Nomenclature
Diols
Functional Groups
For each molecular formula, draw all the possible constitutional isomers of alcohols with that formula. Give the IUPAC name for each alcohol.
(c) C3H6O
For each molecular formula, draw all the possible constitutional isomers of alcohols with that formula. Give the IUPAC name for each alcohol.
(d) C3H4O
Predict which member of each pair will be more soluble in water. Explain the reasons for your answers.
(a) hexan-1-ol or cyclohexanol
(b) heptan-1-ol or 4-methylphenol
(c) 3-ethylhexan-3-ol or octan-2-ol
(d) hexan-2-ol or cyclooctane-1,4-diol
(e)
Give a systematic (IUPAC) name for each diol
(a) CH3CH(OH)(CH2)4CH(OH)C(CH3)3
(b) HO-(CH2)8-OH
(c)
Predict which member of each pair will be more acidic. Explain your answers.
c. 2-chloroethanol or 2,2-dichloroethanol
