뒤로
Bruice 8th EditionCh. 3 - An Introduction to Organic Compounds: Nomenclature, Physical Properties, and Structure문제 1a
a. How many hydrogens does an alkane with 17 carbons have?
b. How many carbons does an alkane with 74 hydrogens have?
문제 2
Draw the structures of octane and isooctane.
문제 3b
Name each of the following:
b.
문제 3c
Name each of the following:
c. <IMAGE>
문제 5a
Draw the structures and name the four constitutional isomers with molecular formula C4H9Br.
문제 6
Which of the following statements can be used to prove that carbon is tetrahedral?
a. CH3Br does not have constitutional isomers.
b. CBr4 does not have a dipole moment.
c. CH2Br2 does not have constitutional isomers.
문제 7a
Draw the structure for each of the following:
a. isopropyl alcohol
문제 7b
Draw the structure for each of the following:
b. isopentyl fluoride
문제 7c
Draw the structure for each of the following:
c. sec-butyl iodide
문제 7d
Draw the structure for each of the following:
d. tert-pentyl alcohol
문제 7e,f
Draw the structure for each of the following:
e. tert-butylamine
f. n-octyl bromide
문제 8a,b
Name the following compounds:
a. CH3OCH2CH3
b. CH3OCH2CH2CH3
문제 8e,f
Name the following compounds:
e.
f.
문제 9c
What is each compound's systematic name?
c.
문제 9d
What is each compound's systematic name?
d.
문제 9g
What is each compound's systematic name?
g. CH3CH2C(CH2CH3)2CH2CH2CH3
문제 9h
What is each compound's systematic name?
h.
문제 11a
Draw the structure for each of the following:
a. 2,2-dimethyl-4-isopropyloctane
문제 11b
Draw the structure for each of the following:
b. 2,2-dimethyl-4-isopropyloctane
문제 11c
Draw the structure for each of the following:
c. 4,4-diethyldecane
문제 11d
Draw the structure for each of the following:
d. 2,4,5-trimethyl-4-(1-methylethyl)heptane
문제 11e
Draw the structure for each of the following:
e. 2,5-dimethyl-4-(2-methylpropyl)octane
문제 11f
Draw the structure for each of the following:
(f) 4-(1,1-dimethylethyl)octane
문제 12b
Give each isomer its systematic name.
문제 12c
How many isomers have common names?
문제 12d
Which isomers contain an isopropyl group?
문제 12f
Which isomers contain a tert-butyl group?
문제 13a,b
Give each substituent on the ten-carbon chain a common name and a parenthetical name
a.
b.
문제 13c,d
Give each substituent on the ten-carbon chain a common name and a parenthetical name
c.
d.
문제 14a
Draw the structure and give the systematic name for a compound with molecular formula C5H12 that has
(a) only primary and secondary hydrogens.
