
Can the hydroxyl group of propan-2-ol be favorably deprotonated by the base potassium ethanolate?

Determine which alcohol in the given pair is more acidic. Give an explanation for your choice.
2-bromoethanol or 2-chloroethanol
Write IUPAC (systematic) names for the following alcohols:

Include stereochemistry if applicable.
For each pair of compounds, determine which of the two compounds has a higher water solubility. Give a brief explanation for your choice.
(i) pentan-1-ol or cyclopentanol
(ii) hexan-1-ol or phenol
(iii) 3-ethylpentan-3-ol or heptan-2-ol
(iv) pentan-2-ol or cyclopentane-1,3-diol
(v)

Draw the correct structure of (R, E)-5-methylhex-3-en-2-ol.
What is the structure of the molecule with an IUPAC name (1R,4S)-4-chlorocyclopent-2-en-1-ol?
What are the IUPAC names of the diols given below?
(i) CH3CH2CH(OH)(CH2)3CH(OH)C(CH3)3
(ii) HO-(CH2)6-OH
(iii)