Bruice 8th Edition
Ch. 3 - An Introduction to Organic Compounds: Nomenclature, Physical Properties, and StructureProblema 1a
a. How many hydrogens does an alkane with 17 carbons have?
b. How many carbons does an alkane with 74 hydrogens have?
Problema 2
Draw the structures of octane and isooctane.
Problema 3b
Name each of the following:
b.
Problema 3c
Name each of the following:
c. <IMAGE>
Problema 5a
Draw the structures and name the four constitutional isomers with molecular formula C4H9Br.
Problema 6
Which of the following statements can be used to prove that carbon is tetrahedral?
a. CH3Br does not have constitutional isomers.
b. CBr4 does not have a dipole moment.
c. CH2Br2 does not have constitutional isomers.
Problema 7a
Draw the structure for each of the following:
a. isopropyl alcohol
Problema 7b
Draw the structure for each of the following:
b. isopentyl fluoride
Problema 7c
Draw the structure for each of the following:
c. sec-butyl iodide
Problema 7d
Draw the structure for each of the following:
d. tert-pentyl alcohol
Problema 7e,f
Draw the structure for each of the following:
e. tert-butylamine
f. n-octyl bromide
Problema 8a,b
Name the following compounds:
a. CH3OCH2CH3
b. CH3OCH2CH2CH3
Problema 8e,f
Name the following compounds:
e.
f.
Problema 9c
What is each compound's systematic name?
c.
Problema 9d
What is each compound's systematic name?
d.
Problema 9g
What is each compound's systematic name?
g. CH3CH2C(CH2CH3)2CH2CH2CH3
Problema 9h
What is each compound's systematic name?
h.
Problema 11a
Draw the structure for each of the following:
a. 2,2-dimethyl-4-isopropyloctane
Problema 11b
Draw the structure for each of the following:
b. 2,2-dimethyl-4-isopropyloctane
Problema 11c
Draw the structure for each of the following:
c. 4,4-diethyldecane
Problema 11d
Draw the structure for each of the following:
d. 2,4,5-trimethyl-4-(1-methylethyl)heptane
Problema 11e
Draw the structure for each of the following:
e. 2,5-dimethyl-4-(2-methylpropyl)octane
Problema 11f
Draw the structure for each of the following:
(f) 4-(1,1-dimethylethyl)octane
Problema 12b
Give each isomer its systematic name.
Problema 12c
How many isomers have common names?
Problema 12d
Which isomers contain an isopropyl group?
Problema 12f
Which isomers contain a tert-butyl group?
Problema 13a,b
Give each substituent on the ten-carbon chain a common name and a parenthetical name
a.
b.
Problema 13c,d
Give each substituent on the ten-carbon chain a common name and a parenthetical name
c.
d.
Problema 14a
Draw the structure and give the systematic name for a compound with molecular formula C5H12 that has
(a) only primary and secondary hydrogens.