Problema 34c
Which of the following structures represent the same compound? Which ones represent different compounds?
(c)
Problema 34e
Which of the following structures represent the same compound? Which ones represent different compounds?
(e)
Problema 34f
Which of the following structures represent the same compound? Which ones represent different compounds?
(f)
Problema 35a
Draw and name the five cycloalkane structures of formula C5H10. Can any of these structures give rise to geometric (cis-trans) isomerism? If so, show the cis and trans stereoisomers.
Problema 36a,b
Draw the structure that corresponds with each name.
a. 3-ethyloctane
b. 4-isopropyldecane
Problema 36c,d
Draw the structure that corresponds with each name.
c. sec-butylcycloheptane
d. 2,3-dimethyl-4-propylnonane
Problema 36e,f
Draw the structure that corresponds with each name.
e. 2,2,4,4-tetramethylhexane
f. trans-1,3-diethylcyclopentane
Problema 36i,j
Draw the structure that corresponds with each name.
i. tert-butylcyclohexane
j. pentylcyclohexane
Problema 37a,b
Each of the following descriptions applies to more than one alkane. In each case, draw and name two structures that match the description.
a. an isopropylheptane
b. a diethyldecane
Problema 37c,d
Each of the following descriptions applies to more than one alkane. In each case, draw and name two structures that match the description.
c. a cis-diethylcyclohexane
d. a trans-dihalocyclopentane
Problema 37e
Each of the following descriptions applies to more than one alkane. In each case, draw and name two structures that match the description.
e. a (2,3-dimethylpentyl)cycloalkane
Problema 37f
Each of the following descriptions applies to more than one alkane. In each case, draw and name two structures that match the description.
f. a bicyclononane
Problema 39a,b
Give the IUPAC names of the following alkanes.
(a) CH3C(CH3)2CH(CH2CH3)CH2CH2CH(CH3)2
(b)
Problema 40a,b
Construct a graph, similar to Figure 3-11, of the torsional energy of 3-methylpentane along the C2―C3 bond.
a. Place C2 in front, represented by three bonds coming together in a Y shape, and C3 in back, represented by a circle with three bonds pointing out from it.
b. Define the dihedral angle as the angle between the methyl group on the front carbon and the ethyl group on the back carbon.
Problema 40c
Construct a graph, similar to Figure 3-11, of the torsional energy of 3-methylpentane along the C2―C3 bond.
c. Begin your graph at the 0° dihedral angle and begin to turn the front carbon.
Problema 40e
Construct a graph, similar to Figure 3-11, of the torsional energy of 3-methylpentane along the C2―C3 bond.
e. Indicate which conformations are the most stable (lowest energy) and the least stable (highest energy).
Problema 41a,b
The following names are all incorrect or incomplete, but they represent real structures. Draw each structure and name it correctly.
a. 2-ethylpentane
b. 3-isopropylhexane
Problema 41c,d
The following names are all incorrect or incomplete, but they represent real structures. Draw each structure and name it correctly.
c. 5-chloro-4-methylhexane
d. 2-dimethylbutane
Problema 41e,f
The following names are all incorrect or incomplete, but they represent real structures. Draw each structure and name it correctly.
e. 2-cyclohexylbutane
f. 2,3-diethylcyclopentane
Problema 42a
In each pair of compounds, which compound has the higher boiling point? Explain your reasoning.
a. octane or 2,2,3-trimethylpentane
Problema 42b
In each pair of compounds, which compound has the higher boiling point? Explain your reasoning.
b. nonane or 2-methylheptane
Problema 42c
In each pair of compounds, which compound has the higher boiling point? Explain your reasoning.
c. 2,2,5-trimethylhexane or nonane
Problema 43a,b
There are eight different five-carbon alkyl groups.
a. Draw them.
b. Give them systematic names.
Problema 43c
There are eight different five-carbon alkyl groups.
c. In each case, label the degree of substitution (primary, secondary, or tertiary) of the head carbon atom bonded to the main chain.
Problema 44a
Use a Newman projection about the indicated bond to draw the most stable conformer for each compound.
a. 3-methylpentane about the C2―C3 bond
Problema 44b
Use a Newman projection about the indicated bond to draw the most stable conformer for each compound.
b. 3,3-dimethylhexane about the C3―C4 bond
Problema 45
a. Draw the two chair conformations of cis-1,3-dimethylcyclohexane, and label all the positions as axial or equatorial.
b. Label the higher-energy conformation and the lower-energy conformation.
c. The energy difference in these two conformations has been measured to be about 23 kJ (5.4 kcal) per mole. How much of this energy difference is due to the torsional energy of gauche relationships?
d. How much energy is due to the additional steric strain of the 1,3-diaxial interaction?
Problema 46a,b
Draw the two chair conformations of each compound, and label the substituents as axial and equatorial. In each case, determine which conformation is more stable.
a. cis-1-ethyl-2-isopropylcyclohexane
b. trans-1-ethyl-2-isopropylcyclohexane
Problema 46c,d
Draw the two chair conformations of each compound, and label the substituents as axial and equatorial. In each case, determine which conformation is more stable.
c. cis-1-ethyl-3-methylcyclohexane
d. trans-1-ethyl-3-methylcyclohexane
Problema 46e,f
Draw the two chair conformations of each compound, and label the substituents as axial and equatorial. In each case, determine which conformation is more stable.
e. cis-1-ethyl-4-methylcyclohexane
f. trans-1-ethyl-4-methylcyclohexane
Ch.3 - Structure and Stereochemistry of Alkanes
