Draw line-angle structures for the compounds (a) through (h).a. CH3(CH2)3CH(CH3)2 b. (CH3)2CHCH2Cl

Ch.1 - Structure and Bonding

Wade9th EditionOrganic ChemistryISBN: 9780135213728당신이 사용하는 게 아니라요?교과서 변경

모든 교과서

Wade 9th Edition

Ch.1 - Structure and Bonding

문제 13a,b

1장, 문제 13a,b

Draw line-angle structures for the compounds (a) through (h).
a. CH₃(CH₂)₃CH(CH₃)₂
b. (CH₃)₂CHCH₂Cl

검증된 단계별 안내

Step 1: Understand the line-angle structure representation. In organic chemistry, line-angle structures are a simplified way to depict molecules. Each vertex represents a carbon atom, and lines represent bonds between them. Hydrogen atoms bonded to carbon are usually not shown explicitly.

Step 2: For compound (a) CH3(CH2)3CH(CH3)2, identify the main carbon chain. The longest chain is five carbons long: CH3-CH2-CH2-CH2-CH(CH3)2. The CH(CH3)2 group is a branching point, indicating a methyl group attached to the fourth carbon.

Step 3: Draw the line-angle structure for compound (a). Start with a zigzag line representing the five-carbon chain. At the fourth carbon, add a branch to represent the two methyl groups (CH3) attached to it.

Step 4: For compound (b) (CH3)2CHCH2Cl, identify the main carbon chain. The longest chain is three carbons long: (CH3)2CH-CH2-Cl. The (CH3)2CH group indicates two methyl groups attached to the first carbon.

Step 5: Draw the line-angle structure for compound (b). Start with a zigzag line representing the three-carbon chain. At the first carbon, add branches to represent the two methyl groups. At the third carbon, add a line to represent the chlorine atom (Cl) attached to it.

비슷한 문제에 대한 검증된 영상 답변:

이 영상 해법은 위 문제에 도움이 된다고 튜터들이 추천한 것입니다.

영상 길이:

도움이 되었나요?

주요 개념

질문에 올바르게 답하기 위해 반드시 이해해야 하는 핵심 개념들은 다음과 같습니다.

Line-Angle Structures

Line-angle structures, also known as skeletal structures, are a simplified way of drawing organic molecules. In these diagrams, carbon atoms are represented by the ends and intersections of lines, while hydrogen atoms attached to carbons are usually omitted for clarity. This method helps in visualizing complex organic molecules more easily.

Alkane Nomenclature

Alkane nomenclature involves naming organic compounds based on the number of carbon atoms and the structure of the carbon chain. The longest continuous chain of carbon atoms determines the base name, while substituents are named and numbered according to their position on the chain. Understanding this is crucial for interpreting and drawing structures from molecular formulas.

Substituents and Branching

Substituents are atoms or groups of atoms attached to the main carbon chain, and branching occurs when a carbon atom is connected to more than two other carbon atoms. Recognizing and correctly placing substituents, such as methyl or chloro groups, is essential for accurately drawing and understanding the structure of organic compounds.