Skip to main content
Ch.10 - Structure and Synthesis of Alcohols
Wade - Organic Chemistry 9th Edition
Wade9th EditionOrganic ChemistryISBN: 9780135213728당신이 사용하는 게 아니라요?교과서 변경
모든 교과서Wade 9th EditionCh.10 - Structure and Synthesis of Alcohols문제 3d
10장, 문제 3d

For each molecular formula, draw all the possible constitutional isomers of alcohols with that formula. Give the IUPAC name for each alcohol.
(d) C3H4O

검증된 단계별 안내
1
Step 1: Understand the problem. Constitutional isomers are compounds with the same molecular formula but different connectivity of atoms. For alcohols, the functional group is -OH (hydroxyl group). We need to determine all possible structures for each molecular formula where the -OH group is attached to different carbon atoms, ensuring unique connectivity.
Step 2: For (a) C3H8O, identify the possible carbon chain arrangements (straight chain or branched) and place the -OH group on different carbons. Ensure that each structure is unique and satisfies the molecular formula. Assign IUPAC names to each structure.
Step 3: For (b) C4H10O, consider all possible carbon chain arrangements (straight chain and branched chains). Place the -OH group on different carbons for each arrangement. Verify that each structure is unique and satisfies the molecular formula. Assign IUPAC names to each alcohol.
Step 4: For (c) C3H6O, note that the molecular formula suggests the presence of a degree of unsaturation (double bond or ring). Consider all possible structures where the -OH group is attached to a carbon in a double-bonded system or a ring. Ensure the structures are unique and assign IUPAC names.
Step 5: For (d) C3H4O, note that the molecular formula suggests two degrees of unsaturation. Consider structures with a combination of double bonds, triple bonds, or rings, ensuring the -OH group is included. Verify uniqueness and assign IUPAC names to each structure.

비슷한 문제에 대한 검증된 영상 답변:

이 영상 해법은 위 문제에 도움이 된다고 튜터들이 추천한 것입니다.
영상 길이:
9m

주요 개념

질문에 올바르게 답하기 위해 반드시 이해해야 하는 핵심 개념들은 다음과 같습니다.

Constitutional Isomers

Constitutional isomers are compounds that have the same molecular formula but differ in the connectivity of their atoms. This means that the arrangement of atoms in the molecule varies, leading to different structural forms. Understanding how to draw and identify these isomers is crucial for determining the various alcohols that can be formed from a given molecular formula.
추천 영상:
01:10
What is a constitutional isomer?

IUPAC Nomenclature

IUPAC nomenclature is a systematic method for naming organic chemical compounds. It provides a set of rules to create unique names based on the structure of the molecule, including the longest carbon chain, functional groups, and their positions. Mastery of IUPAC naming is essential for accurately identifying and communicating the identity of each alcohol isomer.
추천 영상:
03:43
The different parts of an IUPAC name

Functional Groups

Functional groups are specific groups of atoms within molecules that are responsible for the characteristic chemical reactions of those molecules. In the case of alcohols, the hydroxyl group (-OH) is the defining functional group. Recognizing functional groups helps in predicting the properties and reactivity of the compounds, as well as in distinguishing between different types of isomers.
추천 영상:
02:36
Identifying Functional Groups
관련 실천
교과서 질문

For each molecular formula, draw all the possible constitutional isomers of alcohols with that formula. Give the IUPAC name for each alcohol.

(c) C3H6O

734
views
교과서 질문

For each molecular formula, draw all the possible constitutional isomers of alcohols with that formula. Give the IUPAC name for each alcohol.

(b) C4H10O

1246
views
교과서 질문

For each molecular formula, draw all the possible constitutional isomers of alcohols with that formula. Give the IUPAC name for each alcohol.

(a) C3H8O

1041
views
교과서 질문

Give a systematic (IUPAC) name for each diol

(d)

(e)

1149
views
교과서 질문

Predict which member of each pair will be more soluble in water. Explain the reasons for your answers.

(a) hexan-1-ol or cyclohexanol

(b) heptan-1-ol or 4-methylphenol

(c) 3-ethylhexan-3-ol or octan-2-ol

(d) hexan-2-ol or cyclooctane-1,4-diol

(e)


1340
views
교과서 질문

Give a systematic (IUPAC) name for each diol

(a) CH3CH(OH)(CH2)4CH(OH)C(CH3)3

(b) HO-(CH2)8-OH

(c)

1257
views