What is each compound's systematic name?
d.
What is each compound's systematic name?
d.
Draw the structure for each of the following:
d. 2,4,5-trimethyl-4-(1-methylethyl)heptane
Which of the following structures represent the same compound? Which ones represent different compounds?
(a)
Draw the structure for each of the following:
(f) 4-(1,1-dimethylethyl)octane
Give the IUPAC names of the following alkanes.
(a) CH3C(CH3)2CH(CH2CH3)CH2CH2CH(CH3)2
(b)
Make a model of propane (C3H8), and draw this model using dashed lines and wedges to represent bonds going back and coming forward.
Name the following alkanes and haloalkanes. When two or more substituents are present, list them in alphabetical order.
(c)
(d)
Draw skeletal structures for the following:
f. 2,6-dimethyl-4-(2-methylpropyl)decane
A student was given the structural formulas of several compounds and was asked to give them systematic names. How many did the student name correctly? Correct those that are misnamed.
h. 5-ethyl-2-methylhexane
Draw the structure and give the systematic name for a compound with molecular formula C5H12 that has
(c) one tertiary hydrogen