Guided course 01:49Provide the correct common and IUPAC name.Johnny Betancourt1143views17rank14comments
Guided course 00:59Provide the correct common and IUPAC name.Johnny Betancourt1016views15rank11comments
Textbook QuestionPredict which member of each pair has the higher boiling point, and explain the reasons for your predictions. (a) hexan-1-ol or 3,3-dimethylbutan-1-ol (b) hexan-2-one or hexan-2-ol364viewsHas a video solution.
Textbook QuestionPredict which member of each pair will be more soluble in water. Explain the reasons for your answers. (a) hexan-1-ol or cyclohexanol (b) heptan-1-ol or 4-methylphenol (c) 3-ethylhexan-3-ol or octan-2-ol (d) hexan-2-ol or cyclooctane-1,4-diol (e) or 342viewsHas a video solution.
Textbook QuestionDraw the structures of the following compounds. (Includes both new and old names.) (d) 3-cyclopentylhexan-3-ol (e) meso-2,4-pentanediol205viewsHas a video solution.
Textbook QuestionGive systematic (IUPAC) names for the following diols and phenols. (a) (b) 379viewsHas a video solution.
Textbook QuestionPredict which member of each pair will be more acidic. Explain your answers. (d) 2,2-dichloropropan-1-ol or 2,2-difluoropropan-1-ol132viewsHas a video solution.
Textbook QuestionPredict which member of each pair will be more acidic. Explain your answers. (c) 2-chloroethanol or 2,2-dichloroethanol214viewsHas a video solution.
Textbook QuestionPredict which member of each pair is more acidic, and explain the reasons for your predictions. (b) cyclohexanol or cyclohexanethiol221viewsHas a video solution.
Textbook QuestionPredict which member of each pair is more acidic, and explain the reasons for your predictions. (a) cyclopentanol or 3-chlorophenol159viewsHas a video solution.
Textbook QuestionWhich of the following bases would favorably deprotonate a hydroxyl group? (b) NaOH81viewsHas a video solution.
Textbook QuestionWhich of the following bases would favorably deprotonate a hydroxyl group? (c) NaCN75viewsHas a video solution.
Textbook QuestionWhich of the following bases would favorably deprotonate a hydroxyl group? (e)74viewsHas a video solution.
Textbook Question(•) The following molecules were named incorrectly according to IUPAC nomenclature. Give the correct name of these compounds.(a) 3-oxo-5-methylhexan-2-ol59viewsHas a video solution.
Textbook Question(••) Using IUPAC rules, name the following molecules.(d) <IMAGE>57viewsHas a video solution.
Textbook Question(••) Draw the correct structure from the following IUPAC names:(a) (4R,2Z)-4-methylhex-2-en-1-ol47viewsHas a video solution.
Textbook Question(••) Draw the correct structure from the following IUPAC names:(c) (1S,4R)-4-bromocyclohex-2-en-1-ol31viewsHas a video solution.
Textbook QuestionDraw a condensed structure for each of the following:g. 1-bromo-1-pentyneh. 5-methyl-2-cyclohexenol21viewsHas a video solution.
Textbook QuestionGive a systematic (IUPAC) name for each alcohol. Classify each as primary, secondary, or tertiary.(f) <IMAGE>(g) <IMAGE>7viewsHas a video solution.
Textbook QuestionGive a systematic (IUPAC) name for each diol(a) CH3CH(OH)(CH2)4CH(OH)C(CH3)3(b) HO-(CH2)8-OH(c) <IMAGE>15viewsHas a video solution.
Textbook QuestionPredict which member of each group is most soluble in water, and explain the reasons for your predictions.(a) butan-1-ol, pentan-1-ol, or propan-2-ol6viewsHas a video solution.
Textbook QuestionGive a systematic (IUPAC) name for each diol(d) <IMAGE>(e) <IMAGE>10viewsHas a video solution.