A student was given the structural formulas of several compounds and was asked to give them systematic names. How many did the student name correctly? Correct those that are misnamed.
g. 3,3-dichlorooctane
A student was given the structural formulas of several compounds and was asked to give them systematic names. How many did the student name correctly? Correct those that are misnamed.
g. 3,3-dichlorooctane
Draw a condensed structure and a skeletal structure for each of the following:
l. 5-isopropyldecane
Draw a condensed structure and a skeletal structure for each of the following:
k. 3,4-dimethyloctane
What is each compound's systematic name?
h.
What is each compound's systematic name?
g. CH3CH2C(CH2CH3)2CH2CH2CH3
Draw skeletal structures for the following:
f. 2,6-dimethyl-4-(2-methylpropyl)decane
Draw skeletal structures for the following:
e. 2-methyl-4-(1-methylethyl)octane
Give the systematic names for all alkanes with molecular formula C7H16 that do not have any secondary hydrogens.
Draw the structure for each of the following:
e. 2,5-dimethyl-4-(2-methylpropyl)octane
Draw the structure for each of the following:
d. 2,4,5-trimethyl-4-(1-methylethyl)heptane
A student was given the structural formulas of several compounds and was asked to give them systematic names. How many did the student name correctly? Correct those that are misnamed.
k. 2-methyl-2-isopropylheptane
Draw a condensed structure and a skeletal structure for each of the following:
g. 4-(1,1-dimethylethyl)heptane
Correct the following incorrect names using standard IUPAC nomenclature. [Draw a compound that corresponds to the incorrect name, and then rename it.]
(c) 6-ethyl-3-methyloctane
Correct the following incorrect names using standard IUPAC nomenclature. [Draw a compound that corresponds to the incorrect name, and then rename it.]
(d) 4-butyldecane
Correct the following incorrect names using standard IUPAC nomenclature. [Draw a compound that corresponds to the incorrect name, and then rename it.]
(b) 1,5-dimethylcyclohexane