Skip to main content
Ch.10 Acids and Bases
McMurry - Fundamentals of General, Organic, and Biological Chemistry 8th Edition
McMurry8th EditionFundamentals of General, Organic, and Biological ChemistryISBN: 9780134015187Not the one you use?Change textbook
Chapter 10, Problem 103a

One of the buffer systems used to control the pH of blood involves the equilibrium between H2PO4 and H2PO42–. The pKa for H2PO42– is 7.21.
a. Write the Henderson-Hasselbalch equation for this buffer system.

Verified step by step guidance
1
Step 1: Recall the Henderson–Hasselbalch equation, which is used to calculate the pH of a buffer system. The general form of the equation is: pH=pKa+log([A-][HA]), where [A⁻] is the concentration of the conjugate base and [HA] is the concentration of the weak acid.
Step 2: Identify the components of the buffer system in the problem. The weak acid is H₂PO₄⁻, and the conjugate base is HPO₄²⁻.
Step 3: Substitute the given pKₐ value (7.21) and the buffer components into the Henderson–Hasselbalch equation. The equation becomes: pH=7.21+log([HPO42-][H2PO4-]).
Step 4: Understand that this equation allows you to calculate the pH of the buffer system if the concentrations of HPO₄²⁻ and H₂PO₄⁻ are known.
Step 5: Note that the logarithmic term in the equation represents the ratio of the conjugate base concentration to the weak acid concentration. This ratio determines how the buffer resists changes in pH when acids or bases are added.

Verified video answer for a similar problem:

This video solution was recommended by our tutors as helpful for the problem above.
Video duration:
1m
Was this helpful?

Key Concepts

Here are the essential concepts you must grasp in order to answer the question correctly.

Henderson–Hasselbalch Equation

The Henderson–Hasselbalch equation is a mathematical formula used to relate the pH of a solution to the concentration of an acid and its conjugate base. It is expressed as pH = pKa + log([A⁻]/[HA]), where pKa is the acid dissociation constant, [A⁻] is the concentration of the conjugate base, and [HA] is the concentration of the acid. This equation is essential for understanding buffer systems in biological contexts, such as blood pH regulation.
Recommended video:
Guided course
01:22
Henderson-Hasselbalch Equation

Buffer Systems

Buffer systems are solutions that resist changes in pH when small amounts of acid or base are added. They typically consist of a weak acid and its conjugate base, which work together to neutralize added acids or bases. In the context of blood, the phosphate buffer system, involving H₂PO₄⁻ and H₂PO₄²⁻, plays a crucial role in maintaining physiological pH levels, which is vital for proper cellular function.
Recommended video:
Guided course
03:04
Buffer Creation Methods

pKa and Acid-Base Equilibrium

pKa is a measure of the strength of an acid in solution, specifically the pH at which half of the acid is dissociated into its conjugate base. It indicates the tendency of an acid to donate protons (H⁺) in a solution. Understanding pKa is crucial for applying the Henderson–Hasselbalch equation, as it helps predict how changes in the concentrations of the acid and base will affect the overall pH of the buffer system.
Recommended video:
Guided course
03:43
The Equilibrium Constant Example 1
Related Practice
Textbook Question

Obtain a package of Alka-Seltzer, an antacid, from the local drug store:

b. Why does Alka-Seltzer foam and bubble when dissolved in water? Which ingredient is the antacid?

2278
views
Textbook Question

The dissociation of water into H3O+ and OH ions depends on temperature. At 0 °C the [H3O+] = 3.38 x 10–8 M, at 25 °C the [H3O+] = 1.00 x 10–7 M, and at 50 °C the [H3O+] = 2.34 x 10–7 M.

b. What is the value of Kw at 0 °C and 50 °C?

2222
views
Textbook Question

Many allergy medications contain antihistamines, compounds that contain amine groups (R-NH2, where R refers to an organic functional group). Would you expect these compounds to be acidic, basic or neutral? Explain.

a. One over-the-counter product lists the active ingredient as "diphenhydramine HCl." What does this designation mean?

2153
views
Textbook Question

A solution is prepared by bubbling 15.0 L of HCl(g) at 25 °C and 1 atm into 250.0 mL of water.

a. Assuming all the HCl dissolves in the water, how many moles of HCl are in solution?

2505
views
Textbook Question
Research the composition of 'smelling salts'—a product that is used to rouse people who have lost consciousness.What are the chemical reactions that generate the 'active' component?
1846
views
Textbook Question

The dissociation of water into H3O+ and OH ions depends on temperature. At 0 °C the [H3O+] = 3.38 x 10–8 M, at 25 °C the [H3O+] = 1.00 x 10–7 M, and at 50 °C the [H3O+] = 2.34 x 10–7 M.

c. Is the dissociation of water endothermic or exothermic?

2700
views