Skip to main content
Ch.10 - Structure and Synthesis of Alcohols
Wade - Organic Chemistry 9th Edition
Wade9th EditionOrganic ChemistryISBN: 9780135213728Not the one you use?Change textbook
Chapter 10, Problem 21a

Show how you would synthesize the following compound from alkyl halides, vinyl halides, and aryl halides containing no more than six carbon atoms.
(a) octane

Verified step by step guidance
1
Identify the target molecule, octane, which is a straight-chain alkane with eight carbon atoms (C₈H₁₈). The goal is to construct this molecule using smaller alkyl halides, vinyl halides, or aryl halides containing no more than six carbon atoms.
Choose a synthetic strategy. Since octane is a simple alkane, a logical approach is to use a coupling reaction, such as the Wurtz reaction, which involves the coupling of two alkyl halides in the presence of sodium metal to form a longer alkane.
Select appropriate starting materials. To synthesize octane, you can use two alkyl halides with four carbon atoms each, such as 1-bromobutane (C₄H₉Br). This ensures that the total number of carbons in the product will be eight.
Write the reaction mechanism. In the Wurtz reaction, two molecules of 1-bromobutane react with sodium metal in a dry ether solvent. The sodium metal donates electrons to the alkyl halides, forming alkyl radicals, which then couple to form octane. The reaction can be represented as: C4(H9)Br+C4(H9)Br+2NaC8(H18)+2NaBr.
Verify the product. After the reaction, confirm that the product is octane by analyzing its structure and ensuring it matches the target molecule. Additionally, ensure that no side reactions or byproducts interfere with the synthesis.

Verified video answer for a similar problem:

This video solution was recommended by our tutors as helpful for the problem above.
Video duration:
5m
Was this helpful?

Key Concepts

Here are the essential concepts you must grasp in order to answer the question correctly.

Alkyl Halides

Alkyl halides are organic compounds derived from alkanes by replacing one or more hydrogen atoms with halogen atoms (e.g., Cl, Br, I). They serve as important intermediates in organic synthesis, allowing for the formation of various functional groups through nucleophilic substitution or elimination reactions. Understanding their reactivity is crucial for designing synthetic pathways.
Recommended video:
01:52
How to name alkyl halides

Vinyl and Aryl Halides

Vinyl halides contain a halogen atom bonded to a carbon-carbon double bond, while aryl halides have a halogen atom attached to an aromatic ring. These compounds exhibit unique reactivity patterns due to the presence of π bonds or resonance stabilization, which can influence the types of reactions they undergo. Their roles in synthesis often involve coupling reactions or nucleophilic substitutions.
Recommended video:
01:52
How to name alkyl halides

Synthesis Strategies

Synthesis strategies in organic chemistry involve planning a series of chemical reactions to construct a target molecule from simpler precursors. Techniques such as chain elongation, functional group transformations, and coupling reactions are commonly employed. For synthesizing octane, one might consider using alkyl halides in nucleophilic substitution reactions or coupling reactions to build the carbon chain effectively.
Recommended video:
Guided course
1:16
Synthesis of Amino Acids: Strecker Synthesis Example 1