Give structures and names for
a. the five isomers of C6H14
Give structures and names for
a. the five isomers of C6H14
Name the following alkanes and haloalkanes. When two or more substituents are present, list them in alphabetical order.
(a)
All of the following names are incorrect or incomplete. In each case, draw the structure (or a possible structure) and name it correctly.
a. 3-ethyl-4-methylpentane
b. 2-ethyl-3-methylpentane
c. 3-dimethylhexane
Draw the structures of the following compounds.
a. 4-(1,1-dimethylethyl)octane
Which of the following structures represent the same compound? Which ones represent different compounds?
(a)
Provide IUPAC names for the following compounds.
a. (CH3)2CHCH2CH3
b. CH3—C(CH3)2—CH3
c.
Give the IUPAC names of the following alkanes.
(a) CH3C(CH3)2CH(CH2CH3)CH2CH2CH(CH3)2
(b)
Name the following alkanes and haloalkanes. When two or more substituents are present, list them in alphabetical order.
(c)
(d)
The following names are all incorrect or incomplete, but they represent real structures. Draw each structure and name it correctly.
e. 2-cyclohexylbutane
f. 2,3-diethylcyclopentane
The following names are all incorrect or incomplete, but they represent real structures. Draw each structure and name it correctly.
c. 5-chloro-4-methylhexane
d. 2-dimethylbutane
All of the following names are incorrect or incomplete. In each case, draw the structure (or a possible structure) and name it correctly.
d. 4-isobutylheptane
e. 2-bromo-3-ethylbutane
f. 2,3-diethyl-5-isopropylheptane
Draw the structures of the following compounds.
c. 3,3-diethyl-4-(2,2-dimethylpropyl)octane
Draw the structures of the following compounds.
b. 5-(1,2,2-trimethylpropyl)nonane
Provide IUPAC names for the following compounds.
(d)
(e)
(f)
A student was given the structural formulas of several compounds and was asked to give them systematic names. How many did the student name correctly? Correct those that are misnamed.
h. 5-ethyl-2-methylhexane