Organic Chemistry
Improve your experience by picking them
Explain why a locant is not required to identify the primary functional group when naming aldehydes.
Write the IUPAC name for the compound given below.
Name the following compound. Give both an IUPAC and a common name if possible.
Name the carbonyl-containing compound below. If possible, provide both the common and IUPAC names.
CH2(Cl)CH2CH2CH2CH(CH3)CHO
Consider the following compound:
Provide its systematic name, including the configuration of each asymmetric center.
The structure of D-talose is shown below.
Give its systematic name and include the configuration of each asymmetric center.
Draw the corresponding structure for (E)-5-bromopent-4-enal.
Name the following compound. Give both common and IUPAC names, if applicable.
CH3(CH2)4C(CH3)2CH2CHO