Textbook QuestionIdentify the following compounds as primary, secondary, or tertiary amines.a. CH3(CH2)4CH2NH2797views
Textbook QuestionIdentify the following compounds as primary, secondary, or tertiary amines.b. CH3CH2CH2NHCH(CH3)2747views
Textbook QuestionIdentify the following compounds as primary, secondary, or tertiary amines. c. 759views
Textbook Questiona. For the compound above, identify each nitrogen as either a primary, secondary, tertiary, quaternary, or aromatic amine.1371views
Textbook QuestionProvide compounds that fit the following descriptions:a. Two amines that are gases at room temperatureb. A heterocyclic aminec. A compound with an amine group on an aromatic ring836views
Textbook QuestionClassify each of the following amines as primary (1°), secondary (2°), or tertiary (3°):c 656views
Textbook QuestionClassify each of the following amines as primary (1°), secondary (2°), or tertiary (3°):d. 640views
Textbook QuestionClassify each of the following amines as primary (1°), secondary (2°), or tertiary (3°):c. 678views