Textbook QuestionIdentify the following compounds as primary, secondary, or tertiary amines.a. CH3(CH2)4CH2NH2801views
Textbook QuestionIdentify the following compounds as primary, secondary, or tertiary amines.b. CH3CH2CH2NHCH(CH3)2759views
Textbook QuestionIdentify the following compounds as primary, secondary, or tertiary amines. c. 773views
Textbook Questiona. For the compound above, identify each nitrogen as either a primary, secondary, tertiary, quaternary, or aromatic amine.1383views
Textbook QuestionProvide compounds that fit the following descriptions:a. Two amines that are gases at room temperatureb. A heterocyclic aminec. A compound with an amine group on an aromatic ring845views
Textbook QuestionClassify each of the following amines as primary (1°), secondary (2°), or tertiary (3°):c 669views
Textbook QuestionClassify each of the following amines as primary (1°), secondary (2°), or tertiary (3°):d. 651views
Textbook QuestionClassify each of the following amines as primary (1°), secondary (2°), or tertiary (3°):c. 688views