Textbook QuestionIdentify the following compounds as primary, secondary, or tertiary amines.a. CH3(CH2)4CH2NH2794views
Textbook QuestionIdentify the following compounds as primary, secondary, or tertiary amines.b. CH3CH2CH2NHCH(CH3)2740views
Textbook QuestionIdentify the following compounds as primary, secondary, or tertiary amines. c. 756views
Textbook Questiona. For the compound above, identify each nitrogen as either a primary, secondary, tertiary, quaternary, or aromatic amine.1367views
Textbook QuestionProvide compounds that fit the following descriptions:a. Two amines that are gases at room temperatureb. A heterocyclic aminec. A compound with an amine group on an aromatic ring830views
Textbook QuestionClassify each of the following amines as primary (1°), secondary (2°), or tertiary (3°):c 647views
Textbook QuestionClassify each of the following amines as primary (1°), secondary (2°), or tertiary (3°):d. 631views
Textbook QuestionClassify each of the following amines as primary (1°), secondary (2°), or tertiary (3°):c. 665views