Multiple Choice
What is the concentration of H⁺ ions in a 2.0 M solution of acetic acid (HC₂H₃O₂) if the acid dissociation constant (Ka) is 1.8 x 10⁻⁵?
206
views
17. Acid and Base Equilibrium
pH of Weak Acids
Struggling with General Chemistry?
Join thousands of students who trust us to help them ace their exams!Watch the first videoMultiple Choice
What is the pH of a 0.200 M CH3NH3Br solution, given that the Kb of CH3NH2 is 4.4 × 10⁻⁴?
A
3.72
B
7.00
C
5.28
D
8.72
Verified step by step guidance1
Identify that CH3NH3Br is a salt formed from CH3NH2 (a weak base) and HBr (a strong acid). In solution, CH3NH3+ acts as a weak acid.
Write the hydrolysis reaction for CH3NH3+: CH3NH3+ + H2O ⇌ CH3NH2 + H3O+. This reaction shows how CH3NH3+ can donate a proton to water, forming CH3NH2 and H3O+.
Use the relationship between Ka and Kb for conjugate acid-base pairs: Ka × Kb = Kw, where Kw is the ion-product constant of water (1.0 × 10⁻¹⁴ at 25°C). Calculate Ka for CH3NH3+ using the given Kb for CH3NH2.
Set up an ICE (Initial, Change, Equilibrium) table for the hydrolysis reaction to find the concentration of H3O+ at equilibrium. Assume the initial concentration of CH3NH3+ is 0.200 M and the initial concentration of H3O+ is approximately 0.
Use the expression for Ka: Ka = [CH3NH2][H3O+]/[CH3NH3+]. Substitute the equilibrium concentrations from the ICE table into this expression to solve for [H3O+]. Finally, calculate the pH using the formula pH = -log[H3O+].
0:44mWatch next
Master ICE Charts of Weak Acids with a bite sized video explanation from Jules
Start learningRelated Videos
Related Practice
pH of Weak Acids practice set
Problem sets built by lead tutorsExpert video explanations